C8H13F3N2O2S2 — CID 106217534
2-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]butanethioamide (PubChem CID 106217534) has the molecular formula C8H13F3N2O2S2 and a molecular weight of 290.33 g/mol. Its IUPAC name is 2-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]butanethioamide.
| Compound Name | 2-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]butanethioamide |
|---|---|
| PubChem CID | 106217534 |
| Molecular Formula | C8H13F3N2O2S2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 2-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]butanethioamide |
| SMILES | CCC(C(N)=S)S(=O)(=O)NC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H13F3N2O2S2/c1-2-5(6(12)16)17(14,15)13-7(3-4-7)8(9,10)11/h5,13H,2-4H2,1H3,(H2,12,16) |
| InChIKey | FQKWINOHALWLFR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|