C26H31N3O2 — CID 10621889
2-[(2S)-3,3-dimethylbutan-2-yl]-3-[(2R,3S)-2-(2-methylpropanoyl)-3-phenylaziridin-1-yl]quinazolin-4-one (PubChem CID 10621889) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is 2-[(2S)-3,3-dimethylbutan-2-yl]-3-[(2R,3S)-2-(2-methylpropanoyl)-3-phenylaziridin-1-yl]quinazolin-4-one.
| Compound Name | 2-[(2S)-3,3-dimethylbutan-2-yl]-3-[(2R,3S)-2-(2-methylpropanoyl)-3-phenylaziridin-1-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 10621889 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 2-[(2S)-3,3-dimethylbutan-2-yl]-3-[(2R,3S)-2-(2-methylpropanoyl)-3-phenylaziridin-1-yl]quinazolin-4-one |
| SMILES | CC(C)C(=O)[C@H]1[C@H](c2ccccc2)N1n1c([C@@H](C)C(C)(C)C)nc2ccccc2c1=O |
| InChI | InChI=1S/C26H31N3O2/c1-16(2)23(30)22-21(18-12-8-7-9-13-18)28(22)29-24(17(3)26(4,5)6)27-20-15-11-10-14-19(20)25(29)31/h7-17,21-22H,1-6H3/t17-,21+,22-,28?/m1/s1 |
| InChIKey | OLEZKLCDYHUWQS-AYJOWBDTSA-N |
| XLogP | 4.83 |
| TPSA | 54.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|