C10H9F3N2 — CID 106223086
3,5,6-trifluoro-N-pent-4-ynylpyridin-2-amine (PubChem CID 106223086) has the molecular formula C10H9F3N2 and a molecular weight of 214.19 g/mol. Its IUPAC name is 3,5,6-trifluoro-N-pent-4-ynylpyridin-2-amine.
| Compound Name | 3,5,6-trifluoro-N-pent-4-ynylpyridin-2-amine |
|---|---|
| PubChem CID | 106223086 |
| Molecular Formula | C10H9F3N2 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 3,5,6-trifluoro-N-pent-4-ynylpyridin-2-amine |
| SMILES | C#CCCCNc1nc(F)c(F)cc1F |
| InChI | InChI=1S/C10H9F3N2/c1-2-3-4-5-14-10-8(12)6-7(11)9(13)15-10/h1,6H,3-5H2,(H,14,15) |
| InChIKey | AOQGCLGZVNDMAC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|