C12H16F3N3O — CID 114072681
N-tert-butyl-3-[(3,5,6-trifluoro-2-pyridinyl)amino]propanamide (PubChem CID 114072681) has the molecular formula C12H16F3N3O and a molecular weight of 275.27 g/mol. Its IUPAC name is N-tert-butyl-3-[(3,5,6-trifluoro-2-pyridinyl)amino]propanamide.
| Compound Name | N-tert-butyl-3-[(3,5,6-trifluoro-2-pyridinyl)amino]propanamide |
|---|---|
| PubChem CID | 114072681 |
| Molecular Formula | C12H16F3N3O |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N-tert-butyl-3-[(3,5,6-trifluoro-2-pyridinyl)amino]propanamide |
| SMILES | CC(C)(C)NC(=O)CCNc1nc(F)c(F)cc1F |
| InChI | InChI=1S/C12H16F3N3O/c1-12(2,3)18-9(19)4-5-16-11-8(14)6-7(13)10(15)17-11/h6H,4-5H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | STOJPOYVRSTPSU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|