C11H14F3N3O — CID 114072648
N-tert-butyl-2-[(3,5,6-trifluoro-2-pyridinyl)amino]acetamide (PubChem CID 114072648) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is N-tert-butyl-2-[(3,5,6-trifluoro-2-pyridinyl)amino]acetamide.
| Compound Name | N-tert-butyl-2-[(3,5,6-trifluoro-2-pyridinyl)amino]acetamide |
|---|---|
| PubChem CID | 114072648 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-tert-butyl-2-[(3,5,6-trifluoro-2-pyridinyl)amino]acetamide |
| SMILES | CC(C)(C)NC(=O)CNc1nc(F)c(F)cc1F |
| InChI | InChI=1S/C11H14F3N3O/c1-11(2,3)17-8(18)5-15-10-7(13)4-6(12)9(14)16-10/h4H,5H2,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | GOSQYSXRIFXZPD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|