C10H16FN5O — CID 113293343
2-[(2-amino-5-fluoropyrimidin-4-yl)amino]-N-tert-butylacetamide (PubChem CID 113293343) has the molecular formula C10H16FN5O and a molecular weight of 241.27 g/mol. Its IUPAC name is 2-[(2-amino-5-fluoropyrimidin-4-yl)amino]-N-tert-butylacetamide.
| Compound Name | 2-[(2-amino-5-fluoropyrimidin-4-yl)amino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 113293343 |
| Molecular Formula | C10H16FN5O |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2-[(2-amino-5-fluoropyrimidin-4-yl)amino]-N-tert-butylacetamide |
| SMILES | CC(C)(C)NC(=O)CNc1nc(N)ncc1F |
| InChI | InChI=1S/C10H16FN5O/c1-10(2,3)16-7(17)5-13-8-6(11)4-14-9(12)15-8/h4H,5H2,1-3H3,(H,16,17)(H3,12,13,14,15) |
| InChIKey | SPSYYSARLUSEBR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |