C10H17FN4O — CID 107159768
1-[(2-amino-5-fluoropyrimidin-4-yl)amino]-4-methylpentan-2-ol (PubChem CID 107159768) has the molecular formula C10H17FN4O and a molecular weight of 228.27 g/mol. Its IUPAC name is 1-[(2-amino-5-fluoropyrimidin-4-yl)amino]-4-methylpentan-2-ol.
| Compound Name | 1-[(2-amino-5-fluoropyrimidin-4-yl)amino]-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 107159768 |
| Molecular Formula | C10H17FN4O |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 1-[(2-amino-5-fluoropyrimidin-4-yl)amino]-4-methylpentan-2-ol |
| SMILES | CC(C)CC(O)CNc1nc(N)ncc1F |
| InChI | InChI=1S/C10H17FN4O/c1-6(2)3-7(16)4-13-9-8(11)5-14-10(12)15-9/h5-7,16H,3-4H2,1-2H3,(H3,12,13,14,15) |
| InChIKey | GUNHNWRLFQPFES-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |