C23H38O7 — CID 10622359
[(3R,4S,5R)-4-octanoyloxy-8-oxo-1,7-dioxaspiro[4.4]nonan-3-yl] octanoate (PubChem CID 10622359) has the molecular formula C23H38O7 and a molecular weight of 426.55 g/mol. Its IUPAC name is [(3R,4S,5R)-4-octanoyloxy-8-oxo-1,7-dioxaspiro[4.4]nonan-3-yl] octanoate.
| Compound Name | [(3R,4S,5R)-4-octanoyloxy-8-oxo-1,7-dioxaspiro[4.4]nonan-3-yl] octanoate |
|---|---|
| PubChem CID | 10622359 |
| Molecular Formula | C23H38O7 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | [(3R,4S,5R)-4-octanoyloxy-8-oxo-1,7-dioxaspiro[4.4]nonan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@@H]1CO[C@]2(COC(=O)C2)[C@H]1OC(=O)CCCCCCC |
| InChI | InChI=1S/C23H38O7/c1-3-5-7-9-11-13-19(24)29-18-16-28-23(15-21(26)27-17-23)22(18)30-20(25)14-12-10-8-6-4-2/h18,22H,3-17H2,1-2H3/t18-,22+,23-/m1/s1 |
| InChIKey | GWZPRINJEHDRNP-YFXJRYMSSA-N |
| XLogP | 4.25 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|