C20H28ClFN2O5 — CID 10622550
tert-butyl N-[3-(2-amino-5-chloro-3-fluorophenyl)-4-oxobutyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 10622550) has the molecular formula C20H28ClFN2O5 and a molecular weight of 430.90 g/mol. Its IUPAC name is tert-butyl N-[3-(2-amino-5-chloro-3-fluorophenyl)-4-oxobutyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-amino-5-chloro-3-fluorophenyl)-4-oxobutyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 10622550 |
| Molecular Formula | C20H28ClFN2O5 |
| Molecular Weight | 430.90 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | tert-butyl N-[3-(2-amino-5-chloro-3-fluorophenyl)-4-oxobutyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCC(C=O)c1cc(Cl)cc(F)c1N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H28ClFN2O5/c1-19(2,3)28-17(26)24(18(27)29-20(4,5)6)8-7-12(11-25)14-9-13(21)10-15(22)16(14)23/h9-12H,7-8,23H2,1-6H3 |
| InChIKey | DFEMBWSBXAOIQY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.90 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|