C9H13NO2 — CID 106226498
3-pent-1-yn-3-yl-1,3-oxazinan-2-one (PubChem CID 106226498) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 3-pent-1-yn-3-yl-1,3-oxazinan-2-one.
| Compound Name | 3-pent-1-yn-3-yl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 106226498 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 3-pent-1-yn-3-yl-1,3-oxazinan-2-one |
| SMILES | C#CC(CC)N1CCCOC1=O |
| InChI | InChI=1S/C9H13NO2/c1-3-8(4-2)10-6-5-7-12-9(10)11/h1,8H,4-7H2,2H3 |
| InChIKey | JBVQQBLGQOATIA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|