C11H15NO2 — CID 106226501
3,4-dimethyl-1-pent-1-yn-3-ylpyrrolidine-2,5-dione (PubChem CID 106226501) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 3,4-dimethyl-1-pent-1-yn-3-ylpyrrolidine-2,5-dione.
| Compound Name | 3,4-dimethyl-1-pent-1-yn-3-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 106226501 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 3,4-dimethyl-1-pent-1-yn-3-ylpyrrolidine-2,5-dione |
| SMILES | C#CC(CC)N1C(=O)C(C)C(C)C1=O |
| InChI | InChI=1S/C11H15NO2/c1-5-9(6-2)12-10(13)7(3)8(4)11(12)14/h1,7-9H,6H2,2-4H3 |
| InChIKey | NXRQCTZRRCWPEL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|