C9H12N2O2 — CID 61123330
2-(3-methyl-2,5-dioxopyrrolidin-1-yl)butanenitrile (PubChem CID 61123330) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)butanenitrile.
| Compound Name | 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)butanenitrile |
|---|---|
| PubChem CID | 61123330 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)butanenitrile |
| SMILES | CCC(C#N)N1C(=O)CC(C)C1=O |
| InChI | InChI=1S/C9H12N2O2/c1-3-7(5-10)11-8(12)4-6(2)9(11)13/h6-7H,3-4H2,1-2H3 |
| InChIKey | GEWZAOOROSRXTB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|