C8H10N2O2 — CID 61121941
2-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanenitrile (PubChem CID 61121941) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanenitrile.
| Compound Name | 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanenitrile |
|---|---|
| PubChem CID | 61121941 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)propanenitrile |
| SMILES | CC1CC(=O)N(C(C)C#N)C1=O |
| InChI | InChI=1S/C8H10N2O2/c1-5-3-7(11)10(8(5)12)6(2)4-9/h5-6H,3H2,1-2H3 |
| InChIKey | ZSQXQEGUDKWXOH-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|