C17H17NO2 — CID 106228601
N-hex-1-yn-3-yl-1-hydroxynaphthalene-2-carboxamide (PubChem CID 106228601) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is N-hex-1-yn-3-yl-1-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-hex-1-yn-3-yl-1-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 106228601 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N-hex-1-yn-3-yl-1-hydroxynaphthalene-2-carboxamide |
| SMILES | C#CC(CCC)NC(=O)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C17H17NO2/c1-3-7-13(4-2)18-17(20)15-11-10-12-8-5-6-9-14(12)16(15)19/h2,5-6,8-11,13,19H,3,7H2,1H3,(H,18,20) |
| InChIKey | ACSZJIAOLWADBB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|