C13H14BrNOS — CID 114161252
4-bromo-N-hex-1-yn-3-yl-2-sulfanylbenzamide (PubChem CID 114161252) has the molecular formula C13H14BrNOS and a molecular weight of 312.23 g/mol. Its IUPAC name is 4-bromo-N-hex-1-yn-3-yl-2-sulfanylbenzamide.
| Compound Name | 4-bromo-N-hex-1-yn-3-yl-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 114161252 |
| Molecular Formula | C13H14BrNOS |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 4-bromo-N-hex-1-yn-3-yl-2-sulfanylbenzamide |
| SMILES | C#CC(CCC)NC(=O)c1ccc(Br)cc1S |
| InChI | InChI=1S/C13H14BrNOS/c1-3-5-10(4-2)15-13(16)11-7-6-9(14)8-12(11)17/h2,6-8,10,17H,3,5H2,1H3,(H,15,16) |
| InChIKey | BCVPSOVRFAYUHO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|