C14H21BrN2OS — CID 107027574
4-bromo-N-[1-(diethylamino)propan-2-yl]-2-sulfanylbenzamide (PubChem CID 107027574) has the molecular formula C14H21BrN2OS and a molecular weight of 345.31 g/mol. Its IUPAC name is 4-bromo-N-[1-(diethylamino)propan-2-yl]-2-sulfanylbenzamide.
| Compound Name | 4-bromo-N-[1-(diethylamino)propan-2-yl]-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 107027574 |
| Molecular Formula | C14H21BrN2OS |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 4-bromo-N-[1-(diethylamino)propan-2-yl]-2-sulfanylbenzamide |
| SMILES | CCN(CC)CC(C)NC(=O)c1ccc(Br)cc1S |
| InChI | InChI=1S/C14H21BrN2OS/c1-4-17(5-2)9-10(3)16-14(18)12-7-6-11(15)8-13(12)19/h6-8,10,19H,4-5,9H2,1-3H3,(H,16,18) |
| InChIKey | AIXWIPCAPRVQOG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|