C22H36NO6P — CID 10623026
[(2R,3aS,6aS)-2-(hexoxymethyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl 2-pyridin-1-ium-1-ylethyl phosphate (PubChem CID 10623026) has the molecular formula C22H36NO6P and a molecular weight of 441.51 g/mol. Its IUPAC name is [(2R,3aS,6aS)-2-(hexoxymethyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl 2-pyridin-1-ium-1-ylethyl phosphate.
| Compound Name | [(2R,3aS,6aS)-2-(hexoxymethyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl 2-pyridin-1-ium-1-ylethyl phosphate |
|---|---|
| PubChem CID | 10623026 |
| Molecular Formula | C22H36NO6P |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | [(2R,3aS,6aS)-2-(hexoxymethyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl 2-pyridin-1-ium-1-ylethyl phosphate |
| SMILES | CCCCCCOC[C@H]1C[C@]2(COP(=O)([O-])OCC[n+]3ccccc3)CCC[C@@H]2O1 |
| InChI | InChI=1S/C22H36NO6P/c1-2-3-4-8-15-26-18-20-17-22(11-9-10-21(22)29-20)19-28-30(24,25)27-16-14-23-12-6-5-7-13-23/h5-7,12-13,20-21H,2-4,8-11,14-19H2,1H3/t20-,21+,22+/m1/s1 |
| InChIKey | AZHNLYPQHVMEHF-FSSWDIPSSA-N |
| XLogP | 3.40 |
| TPSA | 80.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|