C14H29N3O2 — CID 106235054
2-(aminomethyl)-N-(5-amino-5-oxopentyl)-2-propylpentanamide (PubChem CID 106235054) has the molecular formula C14H29N3O2 and a molecular weight of 271.40 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(5-amino-5-oxopentyl)-2-propylpentanamide.
| Compound Name | 2-(aminomethyl)-N-(5-amino-5-oxopentyl)-2-propylpentanamide |
|---|---|
| PubChem CID | 106235054 |
| Molecular Formula | C14H29N3O2 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 2-(aminomethyl)-N-(5-amino-5-oxopentyl)-2-propylpentanamide |
| SMILES | CCCC(CN)(CCC)C(=O)NCCCCC(N)=O |
| InChI | InChI=1S/C14H29N3O2/c1-3-8-14(11-15,9-4-2)13(19)17-10-6-5-7-12(16)18/h3-11,15H2,1-2H3,(H2,16,18)(H,17,19) |
| InChIKey | CWQCYIYEVOOUPY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|