C16H17Cl2IN4 — CID 10623951
[6-chloro-2-(4-chlorophenyl)imidazo[1,2-b]pyridazin-3-yl]methyl-trimethylazanium iodide (PubChem CID 10623951) has the molecular formula C16H17Cl2IN4 and a molecular weight of 463.15 g/mol. Its IUPAC name is [6-chloro-2-(4-chlorophenyl)imidazo[1,2-b]pyridazin-3-yl]methyl-trimethylazanium iodide.
| Compound Name | [6-chloro-2-(4-chlorophenyl)imidazo[1,2-b]pyridazin-3-yl]methyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 10623951 |
| Molecular Formula | C16H17Cl2IN4 |
| Molecular Weight | 463.15 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | [6-chloro-2-(4-chlorophenyl)imidazo[1,2-b]pyridazin-3-yl]methyl-trimethylazanium iodide |
| SMILES | C[N+](C)(C)Cc1c(-c2ccc(Cl)cc2)nc2ccc(Cl)nn12.[I-] |
| InChI | InChI=1S/C16H17Cl2N4.HI/c1-22(2,3)10-13-16(11-4-6-12(17)7-5-11)19-15-9-8-14(18)20-21(13)15;/h4-9H,10H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | LSTTUYARFMZQEO-UHFFFAOYSA-M |
| XLogP | 0.91 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.15 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|