C13H19NO3S — CID 106246353
(3aS,7aR)-2-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 106246353) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is (3aS,7aR)-2-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aR)-2-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 106246353 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (3aS,7aR)-2-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CSCC(C)(O)CN1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C13H19NO3S/c1-13(17,8-18-2)7-14-11(15)9-5-3-4-6-10(9)12(14)16/h3-4,9-10,17H,5-8H2,1-2H3/t9-,10+,13? |
| InChIKey | IQQHLVKMYXICDO-HWYHXSKPSA-N |
| XLogP | 1.05 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|