C30H33NO5 — CID 10624835
(1R,4S,7S,8R,9S,10R,11R)-3-methyl-8,9,10-tris(phenylmethoxy)-2,6-dioxa-3-azatricyclo[5.3.1.04,11]undecane (PubChem CID 10624835) has the molecular formula C30H33NO5 and a molecular weight of 487.60 g/mol. Its IUPAC name is (1R,4S,7S,8R,9S,10R,11R)-3-methyl-8,9,10-tris(phenylmethoxy)-2,6-dioxa-3-azatricyclo[5.3.1.04,11]undecane.
| Compound Name | (1R,4S,7S,8R,9S,10R,11R)-3-methyl-8,9,10-tris(phenylmethoxy)-2,6-dioxa-3-azatricyclo[5.3.1.04,11]undecane |
|---|---|
| PubChem CID | 10624835 |
| Molecular Formula | C30H33NO5 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | (1R,4S,7S,8R,9S,10R,11R)-3-methyl-8,9,10-tris(phenylmethoxy)-2,6-dioxa-3-azatricyclo[5.3.1.04,11]undecane |
| SMILES | CN1O[C@H]2[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]3OC[C@@H]1[C@H]32 |
| InChI | InChI=1S/C30H33NO5/c1-31-24-20-35-26-25(24)27(36-31)29(33-18-22-13-7-3-8-14-22)30(34-19-23-15-9-4-10-16-23)28(26)32-17-21-11-5-2-6-12-21/h2-16,24-30H,17-20H2,1H3/t24-,25-,26+,27-,28-,29+,30+/m1/s1 |
| InChIKey | OXHKORCAOZFPSU-UCZZSGILSA-N |
| XLogP | 4.39 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |