C29H33NO5 — CID 19918462
1-methyl-4,5,6-tris(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazol-7-ol (PubChem CID 19918462) has the molecular formula C29H33NO5 and a molecular weight of 475.59 g/mol. Its IUPAC name is 1-methyl-4,5,6-tris(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazol-7-ol.
| Compound Name | 1-methyl-4,5,6-tris(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazol-7-ol |
|---|---|
| PubChem CID | 19918462 |
| Molecular Formula | C29H33NO5 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 1-methyl-4,5,6-tris(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazol-7-ol |
| SMILES | CN1OCC2C(OCc3ccccc3)C(OCc3ccccc3)C(OCc3ccccc3)C(O)C21 |
| InChI | InChI=1S/C29H33NO5/c1-30-25-24(20-35-30)27(32-17-21-11-5-2-6-12-21)29(34-19-23-15-9-4-10-16-23)28(26(25)31)33-18-22-13-7-3-8-14-22/h2-16,24-29,31H,17-20H2,1H3 |
| InChIKey | UYPDIDDXRCSRAT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |