C30H35NO6 — CID 135041589
(3aR,5R,6S,7R,7aS)-2,2-dimethyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxyamino)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-ol (PubChem CID 135041589) has the molecular formula C30H35NO6 and a molecular weight of 505.61 g/mol. Its IUPAC name is (3aR,5R,6S,7R,7aS)-2,2-dimethyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxyamino)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-ol.
| Compound Name | (3aR,5R,6S,7R,7aS)-2,2-dimethyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxyamino)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 135041589 |
| Molecular Formula | C30H35NO6 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | (3aR,5R,6S,7R,7aS)-2,2-dimethyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxyamino)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-ol |
| SMILES | CC1(C)O[C@H]2[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)C(NOCc3ccccc3)C(O)[C@H]2O1 |
| InChI | InChI=1S/C30H35NO6/c1-30(2)36-27-25(32)24(31-35-20-23-16-10-5-11-17-23)26(33-18-21-12-6-3-7-13-21)28(29(27)37-30)34-19-22-14-8-4-9-15-22/h3-17,24-29,31-32H,18-20H2,1-2H3/t24?,25?,26-,27+,28+,29+/m0/s1 |
| InChIKey | HJQPHKYVCSVMAW-QHHRPNEZSA-N |
| XLogP | 4.14 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|