C37H41NO6 — CID 19918457
7-[(4-methoxyphenyl)methoxy]-1-methyl-4,5,6-tris(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole (PubChem CID 19918457) has the molecular formula C37H41NO6 and a molecular weight of 595.74 g/mol. Its IUPAC name is 7-[(4-methoxyphenyl)methoxy]-1-methyl-4,5,6-tris(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole.
| Compound Name | 7-[(4-methoxyphenyl)methoxy]-1-methyl-4,5,6-tris(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole |
|---|---|
| PubChem CID | 19918457 |
| Molecular Formula | C37H41NO6 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.29 |
| IUPAC Name | 7-[(4-methoxyphenyl)methoxy]-1-methyl-4,5,6-tris(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole |
| SMILES | COc1ccc(COC2C(OCc3ccccc3)C(OCc3ccccc3)C(OCc3ccccc3)C3CON(C)C32)cc1 |
| InChI | InChI=1S/C37H41NO6/c1-38-33-32(26-44-38)34(40-22-27-12-6-3-7-13-27)36(42-23-28-14-8-4-9-15-28)37(43-24-29-16-10-5-11-17-29)35(33)41-25-30-18-20-31(39-2)21-19-30/h3-21,32-37H,22-26H2,1-2H3 |
| InChIKey | GWMOBPTWVLNXCY-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |