C32H41NO5 — CID 11071398
(1R,2S,3R,4R,5S,6S)-2-(butylamino)-3-(hydroxymethyl)-4,5,6-tris(phenylmethoxy)cyclohexan-1-ol (PubChem CID 11071398) has the molecular formula C32H41NO5 and a molecular weight of 519.68 g/mol. Its IUPAC name is (1R,2S,3R,4R,5S,6S)-2-(butylamino)-3-(hydroxymethyl)-4,5,6-tris(phenylmethoxy)cyclohexan-1-ol.
| Compound Name | (1R,2S,3R,4R,5S,6S)-2-(butylamino)-3-(hydroxymethyl)-4,5,6-tris(phenylmethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 11071398 |
| Molecular Formula | C32H41NO5 |
| Molecular Weight | 519.68 g/mol |
| Exact Mass | 519.30 |
| IUPAC Name | (1R,2S,3R,4R,5S,6S)-2-(butylamino)-3-(hydroxymethyl)-4,5,6-tris(phenylmethoxy)cyclohexan-1-ol |
| SMILES | CCCCN[C@@H]1[C@@H](O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1CO |
| InChI | InChI=1S/C32H41NO5/c1-2-3-19-33-28-27(20-34)30(36-21-24-13-7-4-8-14-24)32(38-23-26-17-11-6-12-18-26)31(29(28)35)37-22-25-15-9-5-10-16-25/h4-18,27-35H,2-3,19-23H2,1H3/t27-,28-,29+,30+,31-,32-/m0/s1 |
| InChIKey | ACRDGGQBZZKWSX-XPCOYVNDSA-N |
| XLogP | 4.48 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.68 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|