C44H44F3NO7 — CID 23241394
2,2,2-trifluoro-N-[(1S,2S,3R,4S,5R,6S)-2-hydroxy-3,4,5,6-tetrakis(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexyl]acetamide (PubChem CID 23241394) has the molecular formula C44H44F3NO7 and a molecular weight of 755.83 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1S,2S,3R,4S,5R,6S)-2-hydroxy-3,4,5,6-tetrakis(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(1S,2S,3R,4S,5R,6S)-2-hydroxy-3,4,5,6-tetrakis(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 23241394 |
| Molecular Formula | C44H44F3NO7 |
| Molecular Weight | 755.83 g/mol |
| Exact Mass | 755.31 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1S,2S,3R,4S,5R,6S)-2-hydroxy-3,4,5,6-tetrakis(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexyl]acetamide |
| SMILES | O=C(N[C@@H]1[C@H](OCc2ccccc2)C(OCc2ccccc2)[C@H](OCc2ccccc2)[C@](COCc2ccccc2)(OCc2ccccc2)[C@H]1O)C(F)(F)F |
| InChI | InChI=1S/C44H44F3NO7/c45-44(46,47)42(50)48-37-38(52-27-33-18-8-2-9-19-33)39(53-28-34-20-10-3-11-21-34)41(54-29-35-22-12-4-13-23-35)43(40(37)49,55-30-36-24-14-5-15-25-36)31-51-26-32-16-6-1-7-17-32/h1-25,37-41,49H,26-31H2,(H,48,50)/t37-,38+,39?,40+,41+,43-/m1/s1 |
| InChIKey | IZWKJJVUOZRUNJ-IUOIPRTNSA-N |
| XLogP | 7.34 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.83 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |