C28H31N3O4 — CID 11754611
(1R,2R,3R,4R,6S)-6-azido-2,3-bis(phenylmethoxy)-4-(phenylmethoxymethyl)cyclohexan-1-ol (PubChem CID 11754611) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is (1R,2R,3R,4R,6S)-6-azido-2,3-bis(phenylmethoxy)-4-(phenylmethoxymethyl)cyclohexan-1-ol.
| Compound Name | (1R,2R,3R,4R,6S)-6-azido-2,3-bis(phenylmethoxy)-4-(phenylmethoxymethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 11754611 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | (1R,2R,3R,4R,6S)-6-azido-2,3-bis(phenylmethoxy)-4-(phenylmethoxymethyl)cyclohexan-1-ol |
| SMILES | [N-]=[N+]=N[C@H]1CC(COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C28H31N3O4/c29-31-30-25-16-24(20-33-17-21-10-4-1-5-11-21)27(34-18-22-12-6-2-7-13-22)28(26(25)32)35-19-23-14-8-3-9-15-23/h1-15,24-28,32H,16-20H2/t24?,25-,26+,27+,28+/m0/s1 |
| InChIKey | OYLTTZOVDYHMQV-OOTAPUKVSA-N |
| XLogP | 5.43 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|