C15H24N2O4 — CID 106250848
methyl 2-amino-5-[(2-hydroxy-4-methoxy-2-methylbutyl)amino]-3-methylbenzoate (PubChem CID 106250848) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is methyl 2-amino-5-[(2-hydroxy-4-methoxy-2-methylbutyl)amino]-3-methylbenzoate.
| Compound Name | methyl 2-amino-5-[(2-hydroxy-4-methoxy-2-methylbutyl)amino]-3-methylbenzoate |
|---|---|
| PubChem CID | 106250848 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | methyl 2-amino-5-[(2-hydroxy-4-methoxy-2-methylbutyl)amino]-3-methylbenzoate |
| SMILES | COCCC(C)(O)CNc1cc(C)c(N)c(C(=O)OC)c1 |
| InChI | InChI=1S/C15H24N2O4/c1-10-7-11(8-12(13(10)16)14(18)21-4)17-9-15(2,19)5-6-20-3/h7-8,17,19H,5-6,9,16H2,1-4H3 |
| InChIKey | SMWFDSQAHVHUKW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|