C13H21ClN2 — CID 106252961
N-[2-(chloromethyl)-2-ethylbutyl]-2-methylpyridin-4-amine (PubChem CID 106252961) has the molecular formula C13H21ClN2 and a molecular weight of 240.78 g/mol. Its IUPAC name is N-[2-(chloromethyl)-2-ethylbutyl]-2-methylpyridin-4-amine.
| Compound Name | N-[2-(chloromethyl)-2-ethylbutyl]-2-methylpyridin-4-amine |
|---|---|
| PubChem CID | 106252961 |
| Molecular Formula | C13H21ClN2 |
| Molecular Weight | 240.78 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | N-[2-(chloromethyl)-2-ethylbutyl]-2-methylpyridin-4-amine |
| SMILES | CCC(CC)(CCl)CNc1ccnc(C)c1 |
| InChI | InChI=1S/C13H21ClN2/c1-4-13(5-2,9-14)10-16-12-6-7-15-11(3)8-12/h6-8H,4-5,9-10H2,1-3H3,(H,15,16) |
| InChIKey | LRHRXABSGKENLR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.78 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|