C14H23ClN2O — CID 106252954
N-[2-(chloromethyl)-2-ethylbutyl]-3-ethoxypyridin-2-amine (PubChem CID 106252954) has the molecular formula C14H23ClN2O and a molecular weight of 270.80 g/mol. Its IUPAC name is N-[2-(chloromethyl)-2-ethylbutyl]-3-ethoxypyridin-2-amine.
| Compound Name | N-[2-(chloromethyl)-2-ethylbutyl]-3-ethoxypyridin-2-amine |
|---|---|
| PubChem CID | 106252954 |
| Molecular Formula | C14H23ClN2O |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N-[2-(chloromethyl)-2-ethylbutyl]-3-ethoxypyridin-2-amine |
| SMILES | CCOc1cccnc1NCC(CC)(CC)CCl |
| InChI | InChI=1S/C14H23ClN2O/c1-4-14(5-2,10-15)11-17-13-12(18-6-3)8-7-9-16-13/h7-9H,4-6,10-11H2,1-3H3,(H,16,17) |
| InChIKey | AFJXPZHVVAJORV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|