C13H18N2OS — CID 106253082
3-[[cyclopropyl(thiophen-2-yl)methyl]amino]-1-methylpyrrolidin-2-one (PubChem CID 106253082) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 3-[[cyclopropyl(thiophen-2-yl)methyl]amino]-1-methylpyrrolidin-2-one.
| Compound Name | 3-[[cyclopropyl(thiophen-2-yl)methyl]amino]-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 106253082 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 3-[[cyclopropyl(thiophen-2-yl)methyl]amino]-1-methylpyrrolidin-2-one |
| SMILES | CN1CCC(NC(c2cccs2)C2CC2)C1=O |
| InChI | InChI=1S/C13H18N2OS/c1-15-7-6-10(13(15)16)14-12(9-4-5-9)11-3-2-8-17-11/h2-3,8-10,12,14H,4-7H2,1H3 |
| InChIKey | XRELNODKHIQWLE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |