C14H19N3O4 — CID 106255777
(2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(1-methyl-2-oxopyrrolidin-3-yl)propanamide (PubChem CID 106255777) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(1-methyl-2-oxopyrrolidin-3-yl)propanamide.
| Compound Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(1-methyl-2-oxopyrrolidin-3-yl)propanamide |
|---|---|
| PubChem CID | 106255777 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(1-methyl-2-oxopyrrolidin-3-yl)propanamide |
| SMILES | CN1CCC(NC(=O)[C@@H](N)Cc2ccc(O)c(O)c2)C1=O |
| InChI | InChI=1S/C14H19N3O4/c1-17-5-4-10(14(17)21)16-13(20)9(15)6-8-2-3-11(18)12(19)7-8/h2-3,7,9-10,18-19H,4-6,15H2,1H3,(H,16,20)/t9-,10?/m0/s1 |
| InChIKey | ZLLBWSONMSNLJG-RGURZIINSA-N |
| XLogP | -0.69 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|