C14H21N3O3 — CID 61465060
(2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(1-methylpyrrolidin-3-yl)propanamide (PubChem CID 61465060) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(1-methylpyrrolidin-3-yl)propanamide.
| Compound Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(1-methylpyrrolidin-3-yl)propanamide |
|---|---|
| PubChem CID | 61465060 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(1-methylpyrrolidin-3-yl)propanamide |
| SMILES | CN1CCC(NC(=O)[C@@H](N)Cc2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C14H21N3O3/c1-17-5-4-10(8-17)16-14(20)11(15)6-9-2-3-12(18)13(19)7-9/h2-3,7,10-11,18-19H,4-6,8,15H2,1H3,(H,16,20)/t10?,11-/m0/s1 |
| InChIKey | AIJBPUDBZUQRKO-DTIOYNMSSA-N |
| XLogP | -0.21 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|