C16H24N2O3 — CID 107413259
(2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-[(3-methylcyclopentyl)methyl]propanamide (PubChem CID 107413259) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-[(3-methylcyclopentyl)methyl]propanamide.
| Compound Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-[(3-methylcyclopentyl)methyl]propanamide |
|---|---|
| PubChem CID | 107413259 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-[(3-methylcyclopentyl)methyl]propanamide |
| SMILES | CC1CCC(CNC(=O)[C@@H](N)Cc2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C16H24N2O3/c1-10-2-3-12(6-10)9-18-16(21)13(17)7-11-4-5-14(19)15(20)8-11/h4-5,8,10,12-13,19-20H,2-3,6-7,9,17H2,1H3,(H,18,21)/t10?,12?,13-/m0/s1 |
| InChIKey | VYSAIEJKHFNDNT-GDKBPFBDSA-N |
| XLogP | 1.52 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|