C8H14ClN3O2S2 — CID 106262441
2-chloro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]ethanesulfonamide (PubChem CID 106262441) has the molecular formula C8H14ClN3O2S2 and a molecular weight of 283.81 g/mol. Its IUPAC name is 2-chloro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]ethanesulfonamide.
| Compound Name | 2-chloro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 106262441 |
| Molecular Formula | C8H14ClN3O2S2 |
| Molecular Weight | 283.81 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 2-chloro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]ethanesulfonamide |
| SMILES | CC(C)Cc1nnc(NS(=O)(=O)CCCl)s1 |
| InChI | InChI=1S/C8H14ClN3O2S2/c1-6(2)5-7-10-11-8(15-7)12-16(13,14)4-3-9/h6H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | GCBMLXIUVYPWHQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.81 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|