C7H12ClN3O2S2 — CID 106262446
1-chloro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]methanesulfonamide (PubChem CID 106262446) has the molecular formula C7H12ClN3O2S2 and a molecular weight of 269.78 g/mol. Its IUPAC name is 1-chloro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]methanesulfonamide.
| Compound Name | 1-chloro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 106262446 |
| Molecular Formula | C7H12ClN3O2S2 |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 1-chloro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]methanesulfonamide |
| SMILES | CC(C)Cc1nnc(NS(=O)(=O)CCl)s1 |
| InChI | InChI=1S/C7H12ClN3O2S2/c1-5(2)3-6-9-10-7(14-6)11-15(12,13)4-8/h5H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | GRQQFILFVAURRT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|