C17H21BrF2O — CID 106264594
2-[(3-bromo-2,6-difluorophenyl)methyl]-4-tert-butylcyclohexan-1-one (PubChem CID 106264594) has the molecular formula C17H21BrF2O and a molecular weight of 359.25 g/mol. Its IUPAC name is 2-[(3-bromo-2,6-difluorophenyl)methyl]-4-tert-butylcyclohexan-1-one.
| Compound Name | 2-[(3-bromo-2,6-difluorophenyl)methyl]-4-tert-butylcyclohexan-1-one |
|---|---|
| PubChem CID | 106264594 |
| Molecular Formula | C17H21BrF2O |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 2-[(3-bromo-2,6-difluorophenyl)methyl]-4-tert-butylcyclohexan-1-one |
| SMILES | CC(C)(C)C1CCC(=O)C(Cc2c(F)ccc(Br)c2F)C1 |
| InChI | InChI=1S/C17H21BrF2O/c1-17(2,3)11-4-7-15(21)10(8-11)9-12-14(19)6-5-13(18)16(12)20/h5-6,10-11H,4,7-9H2,1-3H3 |
| InChIKey | CRCYJUVIFOGKTO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|