C18H23FO2 — CID 83290485
4-tert-butyl-2-[2-(4-fluorophenyl)-2-oxoethyl]cyclohexan-1-one (PubChem CID 83290485) has the molecular formula C18H23FO2 and a molecular weight of 290.38 g/mol. Its IUPAC name is 4-tert-butyl-2-[2-(4-fluorophenyl)-2-oxoethyl]cyclohexan-1-one.
| Compound Name | 4-tert-butyl-2-[2-(4-fluorophenyl)-2-oxoethyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 83290485 |
| Molecular Formula | C18H23FO2 |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 4-tert-butyl-2-[2-(4-fluorophenyl)-2-oxoethyl]cyclohexan-1-one |
| SMILES | CC(C)(C)C1CCC(=O)C(CC(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H23FO2/c1-18(2,3)14-6-9-16(20)13(10-14)11-17(21)12-4-7-15(19)8-5-12/h4-5,7-8,13-14H,6,9-11H2,1-3H3 |
| InChIKey | SWYIVPYMTHOHRT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |