C26H31FO2 — CID 17380236
2-[3-(4-fluorophenyl)-3-oxo-1-phenylpropyl]-4-(2-methylbutan-2-yl)cyclohexan-1-one (PubChem CID 17380236) has the molecular formula C26H31FO2 and a molecular weight of 394.53 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)-3-oxo-1-phenylpropyl]-4-(2-methylbutan-2-yl)cyclohexan-1-one.
| Compound Name | 2-[3-(4-fluorophenyl)-3-oxo-1-phenylpropyl]-4-(2-methylbutan-2-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 17380236 |
| Molecular Formula | C26H31FO2 |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 2-[3-(4-fluorophenyl)-3-oxo-1-phenylpropyl]-4-(2-methylbutan-2-yl)cyclohexan-1-one |
| SMILES | CCC(C)(C)C1CCC(=O)C(C(CC(=O)c2ccc(F)cc2)c2ccccc2)C1 |
| InChI | InChI=1S/C26H31FO2/c1-4-26(2,3)20-12-15-24(28)23(16-20)22(18-8-6-5-7-9-18)17-25(29)19-10-13-21(27)14-11-19/h5-11,13-14,20,22-23H,4,12,15-17H2,1-3H3 |
| InChIKey | VGIOASPJALGNJS-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |