C10H7N5O2S2 — CID 106266826
5-cyano-N-(4-cyano-1-methylpyrazol-3-yl)thiophene-2-sulfonamide (PubChem CID 106266826) has the molecular formula C10H7N5O2S2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 5-cyano-N-(4-cyano-1-methylpyrazol-3-yl)thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-(4-cyano-1-methylpyrazol-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106266826 |
| Molecular Formula | C10H7N5O2S2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 5-cyano-N-(4-cyano-1-methylpyrazol-3-yl)thiophene-2-sulfonamide |
| SMILES | Cn1cc(C#N)c(NS(=O)(=O)c2ccc(C#N)s2)n1 |
| InChI | InChI=1S/C10H7N5O2S2/c1-15-6-7(4-11)10(13-15)14-19(16,17)9-3-2-8(5-12)18-9/h2-3,6H,1H3,(H,13,14) |
| InChIKey | ARAZYYFLECFRFG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |