C14H18Cl2N4O — CID 106278900
3-[6-chloro-2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]-N,2,2-trimethylpropanamide (PubChem CID 106278900) has the molecular formula C14H18Cl2N4O and a molecular weight of 329.23 g/mol. Its IUPAC name is 3-[6-chloro-2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[6-chloro-2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106278900 |
| Molecular Formula | C14H18Cl2N4O |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 3-[6-chloro-2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)Cn1c(CCCl)nc2cc(Cl)cnc21 |
| InChI | InChI=1S/C14H18Cl2N4O/c1-14(2,13(21)17-3)8-20-11(4-5-15)19-10-6-9(16)7-18-12(10)20/h6-7H,4-5,8H2,1-3H3,(H,17,21) |
| InChIKey | CSUZBDITVZHCJR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|