C12H18N4O2 — CID 106280256
N-(3-amino-2,2-dimethyl-3-oxopropyl)-4-hydrazinylbenzamide (PubChem CID 106280256) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethyl-3-oxopropyl)-4-hydrazinylbenzamide.
| Compound Name | N-(3-amino-2,2-dimethyl-3-oxopropyl)-4-hydrazinylbenzamide |
|---|---|
| PubChem CID | 106280256 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | N-(3-amino-2,2-dimethyl-3-oxopropyl)-4-hydrazinylbenzamide |
| SMILES | CC(C)(CNC(=O)c1ccc(NN)cc1)C(N)=O |
| InChI | InChI=1S/C12H18N4O2/c1-12(2,11(13)18)7-15-10(17)8-3-5-9(16-14)6-4-8/h3-6,16H,7,14H2,1-2H3,(H2,13,18)(H,15,17) |
| InChIKey | DALQXTGEAUWELK-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|