C7H16N4O2 — CID 106280285
3-[[amino-(hydroxyamino)methylidene]amino]-N,2,2-trimethylpropanamide (PubChem CID 106280285) has the molecular formula C7H16N4O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-[[amino-(hydroxyamino)methylidene]amino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[[amino-(hydroxyamino)methylidene]amino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106280285 |
| Molecular Formula | C7H16N4O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 3-[[amino-(hydroxyamino)methylidene]amino]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)C/N=C(\N)NO |
| InChI | InChI=1S/C7H16N4O2/c1-7(2,5(12)9-3)4-10-6(8)11-13/h13H,4H2,1-3H3,(H,9,12)(H3,8,10,11) |
| InChIKey | MHIIWZIGLSPODV-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|