C10H18N4O — CID 106281995
N-(oxan-4-ylmethyl)-1-(1H-1,2,4-triazol-5-yl)ethanamine (PubChem CID 106281995) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is N-(oxan-4-ylmethyl)-1-(1H-1,2,4-triazol-5-yl)ethanamine.
| Compound Name | N-(oxan-4-ylmethyl)-1-(1H-1,2,4-triazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 106281995 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | N-(oxan-4-ylmethyl)-1-(1H-1,2,4-triazol-5-yl)ethanamine |
| SMILES | CC(NCC1CCOCC1)c1ncn[nH]1 |
| InChI | InChI=1S/C10H18N4O/c1-8(10-12-7-13-14-10)11-6-9-2-4-15-5-3-9/h7-9,11H,2-6H2,1H3,(H,12,13,14) |
| InChIKey | UHXMWHFUDNKIAI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |