C42H46O5SSi — CID 10628417
[(2R,3R,4S,5S,6R)-4-[tert-butyl(diphenyl)silyl]oxy-3,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methanol (PubChem CID 10628417) has the molecular formula C42H46O5SSi and a molecular weight of 690.98 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-4-[tert-butyl(diphenyl)silyl]oxy-3,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methanol.
| Compound Name | [(2R,3R,4S,5S,6R)-4-[tert-butyl(diphenyl)silyl]oxy-3,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methanol |
|---|---|
| PubChem CID | 10628417 |
| Molecular Formula | C42H46O5SSi |
| Molecular Weight | 690.98 g/mol |
| Exact Mass | 690.28 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-4-[tert-butyl(diphenyl)silyl]oxy-3,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methanol |
| SMILES | CC(C)(C)[Si](O[C@@H]1[C@H](OCc2ccccc2)[C@@H](Sc2ccccc2)O[C@H](CO)[C@H]1OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H46O5SSi/c1-42(2,3)49(35-25-15-7-16-26-35,36-27-17-8-18-28-36)47-39-38(44-30-32-19-9-4-10-20-32)37(29-43)46-41(48-34-23-13-6-14-24-34)40(39)45-31-33-21-11-5-12-22-33/h4-28,37-41,43H,29-31H2,1-3H3/t37-,38-,39+,40+,41-/m1/s1 |
| InChIKey | CSFUWMLKFKMAHK-NEJZJLHVSA-N |
| XLogP | 7.61 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.98 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|