C7H8ClF4N3 — CID 106291258
3-chloro-5-ethyl-4-(2,2,3,3-tetrafluoropropyl)-1,2,4-triazole (PubChem CID 106291258) has the molecular formula C7H8ClF4N3 and a molecular weight of 245.61 g/mol. Its IUPAC name is 3-chloro-5-ethyl-4-(2,2,3,3-tetrafluoropropyl)-1,2,4-triazole.
| Compound Name | 3-chloro-5-ethyl-4-(2,2,3,3-tetrafluoropropyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 106291258 |
| Molecular Formula | C7H8ClF4N3 |
| Molecular Weight | 245.61 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 3-chloro-5-ethyl-4-(2,2,3,3-tetrafluoropropyl)-1,2,4-triazole |
| SMILES | CCc1nnc(Cl)n1CC(F)(F)C(F)F |
| InChI | InChI=1S/C7H8ClF4N3/c1-2-4-13-14-6(8)15(4)3-7(11,12)5(9)10/h5H,2-3H2,1H3 |
| InChIKey | PLLBCXGYJDEWAQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.61 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|