C11H14F4N2O2 — CID 106291294
N-(furan-2-ylmethyl)-2-(2,2,3,3-tetrafluoropropylamino)propanamide (PubChem CID 106291294) has the molecular formula C11H14F4N2O2 and a molecular weight of 282.24 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(2,2,3,3-tetrafluoropropylamino)propanamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(2,2,3,3-tetrafluoropropylamino)propanamide |
|---|---|
| PubChem CID | 106291294 |
| Molecular Formula | C11H14F4N2O2 |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(2,2,3,3-tetrafluoropropylamino)propanamide |
| SMILES | CC(NCC(F)(F)C(F)F)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C11H14F4N2O2/c1-7(17-6-11(14,15)10(12)13)9(18)16-5-8-3-2-4-19-8/h2-4,7,10,17H,5-6H2,1H3,(H,16,18) |
| InChIKey | BGKNNPFMVHETQP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|