C8H10BrF4NO — CID 106292732
3-bromo-1-(2,2,3,3-tetrafluoropropyl)piperidin-2-one (PubChem CID 106292732) has the molecular formula C8H10BrF4NO and a molecular weight of 292.07 g/mol. Its IUPAC name is 3-bromo-1-(2,2,3,3-tetrafluoropropyl)piperidin-2-one.
| Compound Name | 3-bromo-1-(2,2,3,3-tetrafluoropropyl)piperidin-2-one |
|---|---|
| PubChem CID | 106292732 |
| Molecular Formula | C8H10BrF4NO |
| Molecular Weight | 292.07 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 3-bromo-1-(2,2,3,3-tetrafluoropropyl)piperidin-2-one |
| SMILES | O=C1C(Br)CCCN1CC(F)(F)C(F)F |
| InChI | InChI=1S/C8H10BrF4NO/c9-5-2-1-3-14(6(5)15)4-8(12,13)7(10)11/h5,7H,1-4H2 |
| InChIKey | PPDVXBHCMQIJOP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.07 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|