C9H14BrF4N — CID 130673738
3-bromo-2,2-dimethyl-1-(2,2,3,3-tetrafluoropropyl)pyrrolidine (PubChem CID 130673738) has the molecular formula C9H14BrF4N and a molecular weight of 292.11 g/mol. Its IUPAC name is 3-bromo-2,2-dimethyl-1-(2,2,3,3-tetrafluoropropyl)pyrrolidine.
| Compound Name | 3-bromo-2,2-dimethyl-1-(2,2,3,3-tetrafluoropropyl)pyrrolidine |
|---|---|
| PubChem CID | 130673738 |
| Molecular Formula | C9H14BrF4N |
| Molecular Weight | 292.11 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 3-bromo-2,2-dimethyl-1-(2,2,3,3-tetrafluoropropyl)pyrrolidine |
| SMILES | CC1(C)C(Br)CCN1CC(F)(F)C(F)F |
| InChI | InChI=1S/C9H14BrF4N/c1-8(2)6(10)3-4-15(8)5-9(13,14)7(11)12/h6-7H,3-5H2,1-2H3 |
| InChIKey | LFJUMIZSFMSMNO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.11 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|