C11H22BrNO — CID 130658724
1-(3-bromo-2,2-dimethylpropyl)-2,2-dimethylpyrrolidin-3-ol (PubChem CID 130658724) has the molecular formula C11H22BrNO and a molecular weight of 264.21 g/mol. Its IUPAC name is 1-(3-bromo-2,2-dimethylpropyl)-2,2-dimethylpyrrolidin-3-ol.
| Compound Name | 1-(3-bromo-2,2-dimethylpropyl)-2,2-dimethylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 130658724 |
| Molecular Formula | C11H22BrNO |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 1-(3-bromo-2,2-dimethylpropyl)-2,2-dimethylpyrrolidin-3-ol |
| SMILES | CC(C)(CBr)CN1CCC(O)C1(C)C |
| InChI | InChI=1S/C11H22BrNO/c1-10(2,7-12)8-13-6-5-9(14)11(13,3)4/h9,14H,5-8H2,1-4H3 |
| InChIKey | DXSTULCGBSTUPA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|